C15H21IN4O — CID 79096576
2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-6-cyclopropyl-5-iodo-N-methylpyrimidin-4-amine (PubChem CID 79096576) has the molecular formula C15H21IN4O and a molecular weight of 400.26 g/mol. Its IUPAC name is 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-6-cyclopropyl-5-iodo-N-methylpyrimidin-4-amine.
| Compound Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-6-cyclopropyl-5-iodo-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 79096576 |
| Molecular Formula | C15H21IN4O |
| Molecular Weight | 400.26 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-6-cyclopropyl-5-iodo-N-methylpyrimidin-4-amine |
| SMILES | CNc1nc(C2CN3CCCC3CO2)nc(C2CC2)c1I |
| InChI | InChI=1S/C15H21IN4O/c1-17-15-12(16)13(9-4-5-9)18-14(19-15)11-7-20-6-2-3-10(20)8-21-11/h9-11H,2-8H2,1H3,(H,17,18,19) |
| InChIKey | MEZAQUDDBDIYBL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|