C14H20IN3S — CID 80638585
6-cyclopropyl-5-iodo-N-propyl-2-(thiolan-2-yl)pyrimidin-4-amine (PubChem CID 80638585) has the molecular formula C14H20IN3S and a molecular weight of 389.31 g/mol. Its IUPAC name is 6-cyclopropyl-5-iodo-N-propyl-2-(thiolan-2-yl)pyrimidin-4-amine.
| Compound Name | 6-cyclopropyl-5-iodo-N-propyl-2-(thiolan-2-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80638585 |
| Molecular Formula | C14H20IN3S |
| Molecular Weight | 389.31 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 6-cyclopropyl-5-iodo-N-propyl-2-(thiolan-2-yl)pyrimidin-4-amine |
| SMILES | CCCNc1nc(C2CCCS2)nc(C2CC2)c1I |
| InChI | InChI=1S/C14H20IN3S/c1-2-7-16-14-11(15)12(9-5-6-9)17-13(18-14)10-4-3-8-19-10/h9-10H,2-8H2,1H3,(H,16,17,18) |
| InChIKey | FEKNIAGSPXQDSI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.31 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|