C14H23IN4 — CID 115347083
6-cyclopropyl-2-[2-(dimethylamino)ethyl]-5-iodo-N-propylpyrimidin-4-amine (PubChem CID 115347083) has the molecular formula C14H23IN4 and a molecular weight of 374.27 g/mol. Its IUPAC name is 6-cyclopropyl-2-[2-(dimethylamino)ethyl]-5-iodo-N-propylpyrimidin-4-amine.
| Compound Name | 6-cyclopropyl-2-[2-(dimethylamino)ethyl]-5-iodo-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 115347083 |
| Molecular Formula | C14H23IN4 |
| Molecular Weight | 374.27 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 6-cyclopropyl-2-[2-(dimethylamino)ethyl]-5-iodo-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1nc(CCN(C)C)nc(C2CC2)c1I |
| InChI | InChI=1S/C14H23IN4/c1-4-8-16-14-12(15)13(10-5-6-10)17-11(18-14)7-9-19(2)3/h10H,4-9H2,1-3H3,(H,16,17,18) |
| InChIKey | CYLYPINMECWYBH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.27 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|