C14H25BrN4S2 — CID 103347216
[2-(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-1-(5,6-dimethyl-1,4-dithian-2-yl)ethyl]hydrazine (PubChem CID 103347216) has the molecular formula C14H25BrN4S2 and a molecular weight of 393.42 g/mol. Its IUPAC name is [2-(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-1-(5,6-dimethyl-1,4-dithian-2-yl)ethyl]hydrazine.
| Compound Name | [2-(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-1-(5,6-dimethyl-1,4-dithian-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 103347216 |
| Molecular Formula | C14H25BrN4S2 |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | [2-(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-1-(5,6-dimethyl-1,4-dithian-2-yl)ethyl]hydrazine |
| SMILES | CCn1nc(C)c(Br)c1CC(NN)C1CSC(C)C(C)S1 |
| InChI | InChI=1S/C14H25BrN4S2/c1-5-19-12(14(15)8(2)18-19)6-11(17-16)13-7-20-9(3)10(4)21-13/h9-11,13,17H,5-7,16H2,1-4H3 |
| InChIKey | VLAKXTFNABIXKG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|