C14H27BrN6 — CID 105247216
[2-(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-1-(1,4-dimethylpiperazin-2-yl)ethyl]hydrazine (PubChem CID 105247216) has the molecular formula C14H27BrN6 and a molecular weight of 359.32 g/mol. Its IUPAC name is [2-(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-1-(1,4-dimethylpiperazin-2-yl)ethyl]hydrazine.
| Compound Name | [2-(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-1-(1,4-dimethylpiperazin-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105247216 |
| Molecular Formula | C14H27BrN6 |
| Molecular Weight | 359.32 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | [2-(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-1-(1,4-dimethylpiperazin-2-yl)ethyl]hydrazine |
| SMILES | CCn1nc(C)c(Br)c1CC(NN)C1CN(C)CCN1C |
| InChI | InChI=1S/C14H27BrN6/c1-5-21-12(14(15)10(2)18-21)8-11(17-16)13-9-19(3)6-7-20(13)4/h11,13,17H,5-9,16H2,1-4H3 |
| InChIKey | CZHLNLUEOSNMHA-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 62.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.32 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|