C10H9N3O3 — CID 103347853
4-hydroxy-2-(6-methoxy-2-pyridinyl)-1H-pyrimidin-6-one (PubChem CID 103347853) has the molecular formula C10H9N3O3 and a molecular weight of 219.20 g/mol. Its IUPAC name is 4-hydroxy-2-(6-methoxy-2-pyridinyl)-1H-pyrimidin-6-one.
| Compound Name | 4-hydroxy-2-(6-methoxy-2-pyridinyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103347853 |
| Molecular Formula | C10H9N3O3 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 4-hydroxy-2-(6-methoxy-2-pyridinyl)-1H-pyrimidin-6-one |
| SMILES | COc1cccc(-c2nc(O)cc(=O)[nH]2)n1 |
| InChI | InChI=1S/C10H9N3O3/c1-16-9-4-2-3-6(11-9)10-12-7(14)5-8(15)13-10/h2-5H,1H3,(H2,12,13,14,15) |
| InChIKey | HEZQVUVAWZWZRE-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |