C13H15IN4O2 — CID 103348437
5-iodo-6-(methoxymethyl)-2-(6-methoxy-2-pyridinyl)-N-methylpyrimidin-4-amine (PubChem CID 103348437) has the molecular formula C13H15IN4O2 and a molecular weight of 386.19 g/mol. Its IUPAC name is 5-iodo-6-(methoxymethyl)-2-(6-methoxy-2-pyridinyl)-N-methylpyrimidin-4-amine.
| Compound Name | 5-iodo-6-(methoxymethyl)-2-(6-methoxy-2-pyridinyl)-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 103348437 |
| Molecular Formula | C13H15IN4O2 |
| Molecular Weight | 386.19 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | 5-iodo-6-(methoxymethyl)-2-(6-methoxy-2-pyridinyl)-N-methylpyrimidin-4-amine |
| SMILES | CNc1nc(-c2cccc(OC)n2)nc(COC)c1I |
| InChI | InChI=1S/C13H15IN4O2/c1-15-13-11(14)9(7-19-2)17-12(18-13)8-5-4-6-10(16-8)20-3/h4-6H,7H2,1-3H3,(H,15,17,18) |
| InChIKey | ZQLHMNFAZUPURP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.19 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|