C15H14IN3O2 — CID 66302004
2-(1-benzofuran-2-yl)-5-iodo-6-(methoxymethyl)-N-methylpyrimidin-4-amine (PubChem CID 66302004) has the molecular formula C15H14IN3O2 and a molecular weight of 395.20 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-5-iodo-6-(methoxymethyl)-N-methylpyrimidin-4-amine.
| Compound Name | 2-(1-benzofuran-2-yl)-5-iodo-6-(methoxymethyl)-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66302004 |
| Molecular Formula | C15H14IN3O2 |
| Molecular Weight | 395.20 g/mol |
| Exact Mass | 395.01 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-5-iodo-6-(methoxymethyl)-N-methylpyrimidin-4-amine |
| SMILES | CNc1nc(-c2cc3ccccc3o2)nc(COC)c1I |
| InChI | InChI=1S/C15H14IN3O2/c1-17-15-13(16)10(8-20-2)18-14(19-15)12-7-9-5-3-4-6-11(9)21-12/h3-7H,8H2,1-2H3,(H,17,18,19) |
| InChIKey | WIASMNHTAWQCHT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.20 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|