C11H9N3O2 — CID 63091500
3-(1-benzofuran-2-yl)-N-methyl-1,2,4-oxadiazol-5-amine (PubChem CID 63091500) has the molecular formula C11H9N3O2 and a molecular weight of 215.21 g/mol. Its IUPAC name is 3-(1-benzofuran-2-yl)-N-methyl-1,2,4-oxadiazol-5-amine.
| Compound Name | 3-(1-benzofuran-2-yl)-N-methyl-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 63091500 |
| Molecular Formula | C11H9N3O2 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 3-(1-benzofuran-2-yl)-N-methyl-1,2,4-oxadiazol-5-amine |
| SMILES | CNc1nc(-c2cc3ccccc3o2)no1 |
| InChI | InChI=1S/C11H9N3O2/c1-12-11-13-10(14-16-11)9-6-7-4-2-3-5-8(7)15-9/h2-6H,1H3,(H,12,13,14) |
| InChIKey | QEDMFSCEAYDTMU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |