C14H12N2O3 — CID 63344483
4-[3-(1-benzofuran-2-yl)-1,2,4-oxadiazol-5-yl]butan-2-one (PubChem CID 63344483) has the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. Its IUPAC name is 4-[3-(1-benzofuran-2-yl)-1,2,4-oxadiazol-5-yl]butan-2-one.
| Compound Name | 4-[3-(1-benzofuran-2-yl)-1,2,4-oxadiazol-5-yl]butan-2-one |
|---|---|
| PubChem CID | 63344483 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 4-[3-(1-benzofuran-2-yl)-1,2,4-oxadiazol-5-yl]butan-2-one |
| SMILES | CC(=O)CCc1nc(-c2cc3ccccc3o2)no1 |
| InChI | InChI=1S/C14H12N2O3/c1-9(17)6-7-13-15-14(16-19-13)12-8-10-4-2-3-5-11(10)18-12/h2-5,8H,6-7H2,1H3 |
| InChIKey | QSPYJZJDMWIVGW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 69.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |