C16H15BrN2O2 — CID 103350208
4-[(3-amino-5-bromophenyl)methyl]-2,3-dihydro-1,4-benzoxazepin-5-one (PubChem CID 103350208) has the molecular formula C16H15BrN2O2 and a molecular weight of 347.21 g/mol. Its IUPAC name is 4-[(3-amino-5-bromophenyl)methyl]-2,3-dihydro-1,4-benzoxazepin-5-one.
| Compound Name | 4-[(3-amino-5-bromophenyl)methyl]-2,3-dihydro-1,4-benzoxazepin-5-one |
|---|---|
| PubChem CID | 103350208 |
| Molecular Formula | C16H15BrN2O2 |
| Molecular Weight | 347.21 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 4-[(3-amino-5-bromophenyl)methyl]-2,3-dihydro-1,4-benzoxazepin-5-one |
| SMILES | Nc1cc(Br)cc(CN2CCOc3ccccc3C2=O)c1 |
| InChI | InChI=1S/C16H15BrN2O2/c17-12-7-11(8-13(18)9-12)10-19-5-6-21-15-4-2-1-3-14(15)16(19)20/h1-4,7-9H,5-6,10,18H2 |
| InChIKey | ZVDJRGJYKYUJBQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.21 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|