C12H11ClN2O2 — CID 104525972
2-chloro-3-(5-oxo-2,3-dihydro-1,4-benzoxazepin-4-yl)propanenitrile (PubChem CID 104525972) has the molecular formula C12H11ClN2O2 and a molecular weight of 250.69 g/mol. Its IUPAC name is 2-chloro-3-(5-oxo-2,3-dihydro-1,4-benzoxazepin-4-yl)propanenitrile.
| Compound Name | 2-chloro-3-(5-oxo-2,3-dihydro-1,4-benzoxazepin-4-yl)propanenitrile |
|---|---|
| PubChem CID | 104525972 |
| Molecular Formula | C12H11ClN2O2 |
| Molecular Weight | 250.69 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 2-chloro-3-(5-oxo-2,3-dihydro-1,4-benzoxazepin-4-yl)propanenitrile |
| SMILES | N#CC(Cl)CN1CCOc2ccccc2C1=O |
| InChI | InChI=1S/C12H11ClN2O2/c13-9(7-14)8-15-5-6-17-11-4-2-1-3-10(11)12(15)16/h1-4,9H,5-6,8H2 |
| InChIKey | JYQQTSCUQWQMEF-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.69 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|