C14H20N2O2 — CID 104525289
4-[2-(methylamino)butyl]-2,3-dihydro-1,4-benzoxazepin-5-one (PubChem CID 104525289) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 4-[2-(methylamino)butyl]-2,3-dihydro-1,4-benzoxazepin-5-one.
| Compound Name | 4-[2-(methylamino)butyl]-2,3-dihydro-1,4-benzoxazepin-5-one |
|---|---|
| PubChem CID | 104525289 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 4-[2-(methylamino)butyl]-2,3-dihydro-1,4-benzoxazepin-5-one |
| SMILES | CCC(CN1CCOc2ccccc2C1=O)NC |
| InChI | InChI=1S/C14H20N2O2/c1-3-11(15-2)10-16-8-9-18-13-7-5-4-6-12(13)14(16)17/h4-7,11,15H,3,8-10H2,1-2H3 |
| InChIKey | DLAHFUBDMFXKFR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |