C15H19NO4 — CID 104525118
butyl 2-(5-oxo-2,3-dihydro-1,4-benzoxazepin-4-yl)acetate (PubChem CID 104525118) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is butyl 2-(5-oxo-2,3-dihydro-1,4-benzoxazepin-4-yl)acetate.
| Compound Name | butyl 2-(5-oxo-2,3-dihydro-1,4-benzoxazepin-4-yl)acetate |
|---|---|
| PubChem CID | 104525118 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | butyl 2-(5-oxo-2,3-dihydro-1,4-benzoxazepin-4-yl)acetate |
| SMILES | CCCCOC(=O)CN1CCOc2ccccc2C1=O |
| InChI | InChI=1S/C15H19NO4/c1-2-3-9-20-14(17)11-16-8-10-19-13-7-5-4-6-12(13)15(16)18/h4-7H,2-3,8-11H2,1H3 |
| InChIKey | KPPKBMJGJRLSNA-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|