C15H21NO3 — CID 60968558
butyl 2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)acetate (PubChem CID 60968558) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is butyl 2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)acetate.
| Compound Name | butyl 2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)acetate |
|---|---|
| PubChem CID | 60968558 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | butyl 2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)acetate |
| SMILES | CCCCOC(=O)CN1CCOc2ccccc2C1 |
| InChI | InChI=1S/C15H21NO3/c1-2-3-9-19-15(17)12-16-8-10-18-14-7-5-4-6-13(14)11-16/h4-7H,2-3,8-12H2,1H3 |
| InChIKey | WKGCPRXXALUJNL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|