C21H20N2O7 — CID 54438353
bis[2-(4-oxo-2H-1,3-benzoxazin-3-yl)ethyl] carbonate (PubChem CID 54438353) has the molecular formula C21H20N2O7 and a molecular weight of 412.40 g/mol. Its IUPAC name is bis[2-(4-oxo-2H-1,3-benzoxazin-3-yl)ethyl] carbonate.
| Compound Name | bis[2-(4-oxo-2H-1,3-benzoxazin-3-yl)ethyl] carbonate |
|---|---|
| PubChem CID | 54438353 |
| Molecular Formula | C21H20N2O7 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | bis[2-(4-oxo-2H-1,3-benzoxazin-3-yl)ethyl] carbonate |
| SMILES | O=C(OCCN1COc2ccccc2C1=O)OCCN1COc2ccccc2C1=O |
| InChI | InChI=1S/C21H20N2O7/c24-19-15-5-1-3-7-17(15)29-13-22(19)9-11-27-21(26)28-12-10-23-14-30-18-8-4-2-6-16(18)20(23)25/h1-8H,9-14H2 |
| InChIKey | WMHYBKSDJHJLAY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |