C25H30N2O7 — CID 57285161
ethyl 2-carbamoyl-2-ethoxy-3-[4-[2-(4-oxo-2H-1,3-benzoxazin-3-yl)ethoxy]phenyl]butanoate (PubChem CID 57285161) has the molecular formula C25H30N2O7 and a molecular weight of 470.52 g/mol. Its IUPAC name is ethyl 2-carbamoyl-2-ethoxy-3-[4-[2-(4-oxo-2H-1,3-benzoxazin-3-yl)ethoxy]phenyl]butanoate.
| Compound Name | ethyl 2-carbamoyl-2-ethoxy-3-[4-[2-(4-oxo-2H-1,3-benzoxazin-3-yl)ethoxy]phenyl]butanoate |
|---|---|
| PubChem CID | 57285161 |
| Molecular Formula | C25H30N2O7 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | ethyl 2-carbamoyl-2-ethoxy-3-[4-[2-(4-oxo-2H-1,3-benzoxazin-3-yl)ethoxy]phenyl]butanoate |
| SMILES | CCOC(=O)C(OCC)(C(N)=O)C(C)c1ccc(OCCN2COc3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C25H30N2O7/c1-4-31-24(30)25(23(26)29,34-5-2)17(3)18-10-12-19(13-11-18)32-15-14-27-16-33-21-9-7-6-8-20(21)22(27)28/h6-13,17H,4-5,14-16H2,1-3H3,(H2,26,29) |
| InChIKey | YETGUABLLFHQNK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 117.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|