C26H31N3O7 — CID 56975709
ethyl 2-carbamoyl-2-ethoxy-3-[4-[2-(1-methyl-2,4-dioxoquinazolin-3-yl)ethoxy]phenyl]butanoate (PubChem CID 56975709) has the molecular formula C26H31N3O7 and a molecular weight of 497.55 g/mol. Its IUPAC name is ethyl 2-carbamoyl-2-ethoxy-3-[4-[2-(1-methyl-2,4-dioxoquinazolin-3-yl)ethoxy]phenyl]butanoate.
| Compound Name | ethyl 2-carbamoyl-2-ethoxy-3-[4-[2-(1-methyl-2,4-dioxoquinazolin-3-yl)ethoxy]phenyl]butanoate |
|---|---|
| PubChem CID | 56975709 |
| Molecular Formula | C26H31N3O7 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | ethyl 2-carbamoyl-2-ethoxy-3-[4-[2-(1-methyl-2,4-dioxoquinazolin-3-yl)ethoxy]phenyl]butanoate |
| SMILES | CCOC(=O)C(OCC)(C(N)=O)C(C)c1ccc(OCCn2c(=O)c3ccccc3n(C)c2=O)cc1 |
| InChI | InChI=1S/C26H31N3O7/c1-5-34-24(32)26(23(27)31,36-6-2)17(3)18-11-13-19(14-12-18)35-16-15-29-22(30)20-9-7-8-10-21(20)28(4)25(29)33/h7-14,17H,5-6,15-16H2,1-4H3,(H2,27,31) |
| InChIKey | HYVBOGBJMBHLJM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 131.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|