C15H21NO2S — CID 104526932
4-(3-methyl-5-sulfanylpentyl)-2,3-dihydro-1,4-benzoxazepin-5-one (PubChem CID 104526932) has the molecular formula C15H21NO2S and a molecular weight of 279.40 g/mol. Its IUPAC name is 4-(3-methyl-5-sulfanylpentyl)-2,3-dihydro-1,4-benzoxazepin-5-one.
| Compound Name | 4-(3-methyl-5-sulfanylpentyl)-2,3-dihydro-1,4-benzoxazepin-5-one |
|---|---|
| PubChem CID | 104526932 |
| Molecular Formula | C15H21NO2S |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 4-(3-methyl-5-sulfanylpentyl)-2,3-dihydro-1,4-benzoxazepin-5-one |
| SMILES | CC(CCS)CCN1CCOc2ccccc2C1=O |
| InChI | InChI=1S/C15H21NO2S/c1-12(7-11-19)6-8-16-9-10-18-14-5-3-2-4-13(14)15(16)17/h2-5,12,19H,6-11H2,1H3 |
| InChIKey | JVGUXRRUCBXEPM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|