C20H30O2 — CID 10335108
(3aS,5aS,7S,10aS,10bR)-7-hydroxy-3a,5a-dimethyl-8-methylidene-1-propan-2-yl-3,5,6,7,9,10,10a,10b-octahydrocyclohepta[e]inden-4-one (PubChem CID 10335108) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (3aS,5aS,7S,10aS,10bR)-7-hydroxy-3a,5a-dimethyl-8-methylidene-1-propan-2-yl-3,5,6,7,9,10,10a,10b-octahydrocyclohepta[e]inden-4-one.
| Compound Name | (3aS,5aS,7S,10aS,10bR)-7-hydroxy-3a,5a-dimethyl-8-methylidene-1-propan-2-yl-3,5,6,7,9,10,10a,10b-octahydrocyclohepta[e]inden-4-one |
|---|---|
| PubChem CID | 10335108 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (3aS,5aS,7S,10aS,10bR)-7-hydroxy-3a,5a-dimethyl-8-methylidene-1-propan-2-yl-3,5,6,7,9,10,10a,10b-octahydrocyclohepta[e]inden-4-one |
| SMILES | C=C1CC[C@H]2[C@@H]3C(C(C)C)=CC[C@]3(C)C(=O)C[C@]2(C)C[C@@H]1O |
| InChI | InChI=1S/C20H30O2/c1-12(2)14-8-9-20(5)17(22)11-19(4)10-16(21)13(3)6-7-15(19)18(14)20/h8,12,15-16,18,21H,3,6-7,9-11H2,1-2,4-5H3/t15-,16-,18-,19-,20+/m0/s1 |
| InChIKey | YBQUCTGYBPMQDP-CZKCSJLSSA-N |
| XLogP | 4.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|