C9H5F2NO — CID 103351528
5,6-difluoro-2H-isoquinolin-3-one (PubChem CID 103351528) has the molecular formula C9H5F2NO and a molecular weight of 181.14 g/mol. Its IUPAC name is 5,6-difluoro-2H-isoquinolin-3-one.
| Compound Name | 5,6-difluoro-2H-isoquinolin-3-one |
|---|---|
| PubChem CID | 103351528 |
| Molecular Formula | C9H5F2NO |
| Molecular Weight | 181.14 g/mol |
| Exact Mass | 181.03 |
| IUPAC Name | 5,6-difluoro-2H-isoquinolin-3-one |
| SMILES | O=c1cc2c(F)c(F)ccc2c[nH]1 |
| InChI | InChI=1S/C9H5F2NO/c10-7-2-1-5-4-12-8(13)3-6(5)9(7)11/h1-4H,(H,12,13) |
| InChIKey | IYXLMFGMKCVZBE-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.14 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |