About CID 10335382
CID 10335382 (PubChem CID 10335382) has the molecular formula C18H29NO3
and a molecular weight of 307.43 g/mol.
Molecular Properties
| Compound Name | CID 10335382 |
| PubChem CID | 10335382 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | — |
| SMILES | NCCC1CCC2(CC1)OOC1(O2)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C18H29NO3/c19-6-3-12-1-4-17(5-2-12)20-18(22-21-17)15-8-13-7-14(10-15)11-16(18)9-13/h12-16H,1-11,19H2 |
| InChIKey | PSNKTRXMIPMFRW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 10335382 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10335382?
The IUPAC name of CID 10335382 (CID 10335382) is not available.
What is the SMILES notation for CID 10335382?
The canonical SMILES for CID 10335382 is NCCC1CCC2(CC1)OOC1(O2)C2CC3CC(C2)CC1C3.
What is the InChIKey of CID 10335382?
The InChIKey is PSNKTRXMIPMFRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29NO3/c19-6-3-12-1-4-17(5-2-12)20-18(22-21-17)15-8-13-7-14(10-15)11-16(18)9-13/h12-16H,1-11,19H2.
What are the key properties of CID 10335382?
CID 10335382 has a molecular weight of 307.43 g/mol, XLogP of 3.35, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10335382 is sourced from PubChem (CID 10335382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).