C13H13ClO4 — CID 103354958
methyl 2'-chloro-5-methoxyspiro[1,2-dihydroindene-3,3'-oxirane]-2'-carboxylate (PubChem CID 103354958) has the molecular formula C13H13ClO4 and a molecular weight of 268.70 g/mol. Its IUPAC name is methyl 2'-chloro-5-methoxyspiro[1,2-dihydroindene-3,3'-oxirane]-2'-carboxylate.
| Compound Name | methyl 2'-chloro-5-methoxyspiro[1,2-dihydroindene-3,3'-oxirane]-2'-carboxylate |
|---|---|
| PubChem CID | 103354958 |
| Molecular Formula | C13H13ClO4 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | methyl 2'-chloro-5-methoxyspiro[1,2-dihydroindene-3,3'-oxirane]-2'-carboxylate |
| SMILES | COC(=O)C1(Cl)OC12CCc1ccc(OC)cc12 |
| InChI | InChI=1S/C13H13ClO4/c1-16-9-4-3-8-5-6-12(10(8)7-9)13(14,18-12)11(15)17-2/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | MEETULPUEOFUAJ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|