C11H23N3O — CID 103356376
4-(3-hydroxy-3-methylpyrrolidin-1-yl)-2,2-dimethylbutanimidamide (PubChem CID 103356376) has the molecular formula C11H23N3O and a molecular weight of 213.32 g/mol. Its IUPAC name is 4-(3-hydroxy-3-methylpyrrolidin-1-yl)-2,2-dimethylbutanimidamide.
| Compound Name | 4-(3-hydroxy-3-methylpyrrolidin-1-yl)-2,2-dimethylbutanimidamide |
|---|---|
| PubChem CID | 103356376 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | 4-(3-hydroxy-3-methylpyrrolidin-1-yl)-2,2-dimethylbutanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCN1CCC(C)(O)C1 |
| InChI | InChI=1S/C11H23N3O/c1-10(2,9(12)13)4-6-14-7-5-11(3,15)8-14/h15H,4-8H2,1-3H3,(H3,12,13) |
| InChIKey | OOYXAZLAVOIVIL-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|