C11H21NO2 — CID 103357582
1-[(1R,2R)-2-hydroxycyclohexyl]-3-methylpyrrolidin-3-ol (PubChem CID 103357582) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is 1-[(1R,2R)-2-hydroxycyclohexyl]-3-methylpyrrolidin-3-ol.
| Compound Name | 1-[(1R,2R)-2-hydroxycyclohexyl]-3-methylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 103357582 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 1-[(1R,2R)-2-hydroxycyclohexyl]-3-methylpyrrolidin-3-ol |
| SMILES | CC1(O)CCN([C@@H]2CCCC[C@H]2O)C1 |
| InChI | InChI=1S/C11H21NO2/c1-11(14)6-7-12(8-11)9-4-2-3-5-10(9)13/h9-10,13-14H,2-8H2,1H3/t9-,10-,11?/m1/s1 |
| InChIKey | NPGCZUIRDKNKRK-DIOIDXFWSA-N |
| XLogP | 0.75 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |