C15H30N2O2 — CID 103358497
3-methyl-1-[[3-[(2-methylpropylamino)methyl]oxolan-3-yl]methyl]pyrrolidin-3-ol (PubChem CID 103358497) has the molecular formula C15H30N2O2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 3-methyl-1-[[3-[(2-methylpropylamino)methyl]oxolan-3-yl]methyl]pyrrolidin-3-ol.
| Compound Name | 3-methyl-1-[[3-[(2-methylpropylamino)methyl]oxolan-3-yl]methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 103358497 |
| Molecular Formula | C15H30N2O2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | 3-methyl-1-[[3-[(2-methylpropylamino)methyl]oxolan-3-yl]methyl]pyrrolidin-3-ol |
| SMILES | CC(C)CNCC1(CN2CCC(C)(O)C2)CCOC1 |
| InChI | InChI=1S/C15H30N2O2/c1-13(2)8-16-9-15(5-7-19-12-15)11-17-6-4-14(3,18)10-17/h13,16,18H,4-12H2,1-3H3 |
| InChIKey | IKTKYLDNCXNKII-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |