C16H32N2O2 — CID 81116507
4-methyl-1-[[3-(propylaminomethyl)oxan-3-yl]methyl]piperidin-4-ol (PubChem CID 81116507) has the molecular formula C16H32N2O2 and a molecular weight of 284.44 g/mol. Its IUPAC name is 4-methyl-1-[[3-(propylaminomethyl)oxan-3-yl]methyl]piperidin-4-ol.
| Compound Name | 4-methyl-1-[[3-(propylaminomethyl)oxan-3-yl]methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 81116507 |
| Molecular Formula | C16H32N2O2 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | 4-methyl-1-[[3-(propylaminomethyl)oxan-3-yl]methyl]piperidin-4-ol |
| SMILES | CCCNCC1(CN2CCC(C)(O)CC2)CCCOC1 |
| InChI | InChI=1S/C16H32N2O2/c1-3-8-17-12-16(5-4-11-20-14-16)13-18-9-6-15(2,19)7-10-18/h17,19H,3-14H2,1-2H3 |
| InChIKey | PLPHNSSKQAULHJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|