C17H34N2O2 — CID 63739810
N-[[3-[(2,2,6-trimethylmorpholin-4-yl)methyl]oxan-3-yl]methyl]propan-1-amine (PubChem CID 63739810) has the molecular formula C17H34N2O2 and a molecular weight of 298.47 g/mol. Its IUPAC name is N-[[3-[(2,2,6-trimethylmorpholin-4-yl)methyl]oxan-3-yl]methyl]propan-1-amine.
| Compound Name | N-[[3-[(2,2,6-trimethylmorpholin-4-yl)methyl]oxan-3-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 63739810 |
| Molecular Formula | C17H34N2O2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.26 |
| IUPAC Name | N-[[3-[(2,2,6-trimethylmorpholin-4-yl)methyl]oxan-3-yl]methyl]propan-1-amine |
| SMILES | CCCNCC1(CN2CC(C)OC(C)(C)C2)CCCOC1 |
| InChI | InChI=1S/C17H34N2O2/c1-5-8-18-11-17(7-6-9-20-14-17)13-19-10-15(2)21-16(3,4)12-19/h15,18H,5-14H2,1-4H3 |
| InChIKey | CEIOFGDSFLXHPI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|