About N-[[3-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]oxan-3-yl]methyl]ethanamine
N-[[3-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]oxan-3-yl]methyl]ethanamine (PubChem CID 104960751) has the molecular formula C15H30N2O2
and a molecular weight of 270.42 g/mol. Its IUPAC name is N-[[3-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]oxan-3-yl]methyl]ethanamine.
Molecular Properties
| Compound Name | N-[[3-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]oxan-3-yl]methyl]ethanamine |
| PubChem CID | 104960751 |
| Molecular Formula | C15H30N2O2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | N-[[3-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]oxan-3-yl]methyl]ethanamine |
| SMILES | CCNCC1(CN2C[C@@H](C)O[C@@H](C)C2)CCCOC1 |
| InChI | InChI=1S/C15H30N2O2/c1-4-16-10-15(6-5-7-18-12-15)11-17-8-13(2)19-14(3)9-17/h13-14,16H,4-12H2,1-3H3/t13-,14+,15? |
| InChIKey | OSIBXHKHBYGBBC-YIONKMFJSA-N |
| XLogP | 1.50 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[3-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]oxan-3-yl]methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]oxan-3-yl]methyl]ethanamine?
The IUPAC name of N-[[3-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]oxan-3-yl]methyl]ethanamine (CID 104960751) is N-[[3-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]oxan-3-yl]methyl]ethanamine.
What is the SMILES notation for N-[[3-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]oxan-3-yl]methyl]ethanamine?
The canonical SMILES for N-[[3-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]oxan-3-yl]methyl]ethanamine is CCNCC1(CN2C[C@@H](C)O[C@@H](C)C2)CCCOC1.
What is the InChIKey of N-[[3-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]oxan-3-yl]methyl]ethanamine?
The InChIKey is OSIBXHKHBYGBBC-YIONKMFJSA-N. The full InChI is InChI=1S/C15H30N2O2/c1-4-16-10-15(6-5-7-18-12-15)11-17-8-13(2)19-14(3)9-17/h13-14,16H,4-12H2,1-3H3/t13-,14+,15?.
What are the key properties of N-[[3-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]oxan-3-yl]methyl]ethanamine?
N-[[3-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]oxan-3-yl]methyl]ethanamine has a molecular weight of 270.42 g/mol, XLogP of 1.50, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]oxan-3-yl]methyl]ethanamine is sourced from PubChem (CID 104960751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).