C12H16N4OS — CID 103359777
4-[(3-amino-4-pyridin-4-yl-1,2-thiazol-5-yl)amino]butan-2-ol (PubChem CID 103359777) has the molecular formula C12H16N4OS and a molecular weight of 264.35 g/mol. Its IUPAC name is 4-[(3-amino-4-pyridin-4-yl-1,2-thiazol-5-yl)amino]butan-2-ol.
| Compound Name | 4-[(3-amino-4-pyridin-4-yl-1,2-thiazol-5-yl)amino]butan-2-ol |
|---|---|
| PubChem CID | 103359777 |
| Molecular Formula | C12H16N4OS |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 4-[(3-amino-4-pyridin-4-yl-1,2-thiazol-5-yl)amino]butan-2-ol |
| SMILES | CC(O)CCNc1snc(N)c1-c1ccncc1 |
| InChI | InChI=1S/C12H16N4OS/c1-8(17)2-7-15-12-10(11(13)16-18-12)9-3-5-14-6-4-9/h3-6,8,15,17H,2,7H2,1H3,(H2,13,16) |
| InChIKey | UTYLQDVHZKQCJA-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |