C13H18N4O2S — CID 106311959
2-[3-[(3-amino-4-pyridin-4-yl-1,2-thiazol-5-yl)amino]propoxy]ethanol (PubChem CID 106311959) has the molecular formula C13H18N4O2S and a molecular weight of 294.38 g/mol. Its IUPAC name is 2-[3-[(3-amino-4-pyridin-4-yl-1,2-thiazol-5-yl)amino]propoxy]ethanol.
| Compound Name | 2-[3-[(3-amino-4-pyridin-4-yl-1,2-thiazol-5-yl)amino]propoxy]ethanol |
|---|---|
| PubChem CID | 106311959 |
| Molecular Formula | C13H18N4O2S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2-[3-[(3-amino-4-pyridin-4-yl-1,2-thiazol-5-yl)amino]propoxy]ethanol |
| SMILES | Nc1nsc(NCCCOCCO)c1-c1ccncc1 |
| InChI | InChI=1S/C13H18N4O2S/c14-12-11(10-2-5-15-6-3-10)13(20-17-12)16-4-1-8-19-9-7-18/h2-3,5-6,16,18H,1,4,7-9H2,(H2,14,17) |
| InChIKey | PAYZEHBKIVSKAE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|