C11H13N3OS — CID 103360202
5-N-(2-phenoxyethyl)-1,2-thiazole-3,5-diamine (PubChem CID 103360202) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is 5-N-(2-phenoxyethyl)-1,2-thiazole-3,5-diamine.
| Compound Name | 5-N-(2-phenoxyethyl)-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103360202 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 5-N-(2-phenoxyethyl)-1,2-thiazole-3,5-diamine |
| SMILES | Nc1cc(NCCOc2ccccc2)sn1 |
| InChI | InChI=1S/C11H13N3OS/c12-10-8-11(16-14-10)13-6-7-15-9-4-2-1-3-5-9/h1-5,8,13H,6-7H2,(H2,12,14) |
| InChIKey | DLRWCEMKIIPZEU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|