C13H23N3S — CID 103360617
5-(4-tert-butylpiperidin-1-yl)-4-methyl-1,2-thiazol-3-amine (PubChem CID 103360617) has the molecular formula C13H23N3S and a molecular weight of 253.41 g/mol. Its IUPAC name is 5-(4-tert-butylpiperidin-1-yl)-4-methyl-1,2-thiazol-3-amine.
| Compound Name | 5-(4-tert-butylpiperidin-1-yl)-4-methyl-1,2-thiazol-3-amine |
|---|---|
| PubChem CID | 103360617 |
| Molecular Formula | C13H23N3S |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 5-(4-tert-butylpiperidin-1-yl)-4-methyl-1,2-thiazol-3-amine |
| SMILES | Cc1c(N)nsc1N1CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C13H23N3S/c1-9-11(14)15-17-12(9)16-7-5-10(6-8-16)13(2,3)4/h10H,5-8H2,1-4H3,(H2,14,15) |
| InChIKey | RBRCSLDDQFTOEI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |