C10H10ClN3S — CID 103361005
5-N-[(3-chlorophenyl)methyl]-1,2-thiazole-3,5-diamine (PubChem CID 103361005) has the molecular formula C10H10ClN3S and a molecular weight of 239.73 g/mol. Its IUPAC name is 5-N-[(3-chlorophenyl)methyl]-1,2-thiazole-3,5-diamine.
| Compound Name | 5-N-[(3-chlorophenyl)methyl]-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103361005 |
| Molecular Formula | C10H10ClN3S |
| Molecular Weight | 239.73 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 5-N-[(3-chlorophenyl)methyl]-1,2-thiazole-3,5-diamine |
| SMILES | Nc1cc(NCc2cccc(Cl)c2)sn1 |
| InChI | InChI=1S/C10H10ClN3S/c11-8-3-1-2-7(4-8)6-13-10-5-9(12)14-15-10/h1-5,13H,6H2,(H2,12,14) |
| InChIKey | JLHSXXDLYMWHSZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.73 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |