C12H13ClN4 — CID 155130266
5-N-[(3-chlorophenyl)methyl]pyridine-2,3,5-triamine (PubChem CID 155130266) has the molecular formula C12H13ClN4 and a molecular weight of 248.72 g/mol. Its IUPAC name is 5-N-[(3-chlorophenyl)methyl]pyridine-2,3,5-triamine.
| Compound Name | 5-N-[(3-chlorophenyl)methyl]pyridine-2,3,5-triamine |
|---|---|
| PubChem CID | 155130266 |
| Molecular Formula | C12H13ClN4 |
| Molecular Weight | 248.72 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 5-N-[(3-chlorophenyl)methyl]pyridine-2,3,5-triamine |
| SMILES | Nc1cc(NCc2cccc(Cl)c2)cnc1N |
| InChI | InChI=1S/C12H13ClN4/c13-9-3-1-2-8(4-9)6-16-10-5-11(14)12(15)17-7-10/h1-5,7,16H,6,14H2,(H2,15,17) |
| InChIKey | RYTPMOPSOLEJOT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.72 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |