C18H27NO4 — CID 10336195
2-(4-cyclohexylphenyl)-2-hydroxy-N-(methoxymethoxy)butanamide (PubChem CID 10336195) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is 2-(4-cyclohexylphenyl)-2-hydroxy-N-(methoxymethoxy)butanamide.
| Compound Name | 2-(4-cyclohexylphenyl)-2-hydroxy-N-(methoxymethoxy)butanamide |
|---|---|
| PubChem CID | 10336195 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 2-(4-cyclohexylphenyl)-2-hydroxy-N-(methoxymethoxy)butanamide |
| SMILES | CCC(O)(C(=O)NOCOC)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C18H27NO4/c1-3-18(21,17(20)19-23-13-22-2)16-11-9-15(10-12-16)14-7-5-4-6-8-14/h9-12,14,21H,3-8,13H2,1-2H3,(H,19,20) |
| InChIKey | BQKJKYWHVYYYJN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|