C10H19N3OS — CID 103362406
5-N-butyl-4-ethoxy-5-N-methyl-1,2-thiazole-3,5-diamine (PubChem CID 103362406) has the molecular formula C10H19N3OS and a molecular weight of 229.35 g/mol. Its IUPAC name is 5-N-butyl-4-ethoxy-5-N-methyl-1,2-thiazole-3,5-diamine.
| Compound Name | 5-N-butyl-4-ethoxy-5-N-methyl-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103362406 |
| Molecular Formula | C10H19N3OS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 5-N-butyl-4-ethoxy-5-N-methyl-1,2-thiazole-3,5-diamine |
| SMILES | CCCCN(C)c1snc(N)c1OCC |
| InChI | InChI=1S/C10H19N3OS/c1-4-6-7-13(3)10-8(14-5-2)9(11)12-15-10/h4-7H2,1-3H3,(H2,11,12) |
| InChIKey | CINDAFYLTQOUOV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |