C11H22N4O3S2 — CID 103362965
3-amino-5-[2-ethoxyethyl(ethyl)amino]-N,N-dimethyl-1,2-thiazole-4-sulfonamide (PubChem CID 103362965) has the molecular formula C11H22N4O3S2 and a molecular weight of 322.46 g/mol. Its IUPAC name is 3-amino-5-[2-ethoxyethyl(ethyl)amino]-N,N-dimethyl-1,2-thiazole-4-sulfonamide.
| Compound Name | 3-amino-5-[2-ethoxyethyl(ethyl)amino]-N,N-dimethyl-1,2-thiazole-4-sulfonamide |
|---|---|
| PubChem CID | 103362965 |
| Molecular Formula | C11H22N4O3S2 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 3-amino-5-[2-ethoxyethyl(ethyl)amino]-N,N-dimethyl-1,2-thiazole-4-sulfonamide |
| SMILES | CCOCCN(CC)c1snc(N)c1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C11H22N4O3S2/c1-5-15(7-8-18-6-2)11-9(10(12)13-19-11)20(16,17)14(3)4/h5-8H2,1-4H3,(H2,12,13) |
| InChIKey | BFOQTTRCFYKRCA-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|