C16H13F3N2 — CID 103366890
3,3,3-trifluoro-2-[(2-phenylanilino)methyl]propanenitrile (PubChem CID 103366890) has the molecular formula C16H13F3N2 and a molecular weight of 290.29 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(2-phenylanilino)methyl]propanenitrile.
| Compound Name | 3,3,3-trifluoro-2-[(2-phenylanilino)methyl]propanenitrile |
|---|---|
| PubChem CID | 103366890 |
| Molecular Formula | C16H13F3N2 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 3,3,3-trifluoro-2-[(2-phenylanilino)methyl]propanenitrile |
| SMILES | N#CC(CNc1ccccc1-c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H13F3N2/c17-16(18,19)13(10-20)11-21-15-9-5-4-8-14(15)12-6-2-1-3-7-12/h1-9,13,21H,11H2 |
| InChIKey | JIDPXORPMPKULT-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |