C8H12F3N3O — CID 103367047
N-[2-[(2-cyano-3,3,3-trifluoropropyl)amino]ethyl]acetamide (PubChem CID 103367047) has the molecular formula C8H12F3N3O and a molecular weight of 223.20 g/mol. Its IUPAC name is N-[2-[(2-cyano-3,3,3-trifluoropropyl)amino]ethyl]acetamide.
| Compound Name | N-[2-[(2-cyano-3,3,3-trifluoropropyl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 103367047 |
| Molecular Formula | C8H12F3N3O |
| Molecular Weight | 223.20 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | N-[2-[(2-cyano-3,3,3-trifluoropropyl)amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNCC(C#N)C(F)(F)F |
| InChI | InChI=1S/C8H12F3N3O/c1-6(15)14-3-2-13-5-7(4-12)8(9,10)11/h7,13H,2-3,5H2,1H3,(H,14,15) |
| InChIKey | YRIBQKUEPBROMZ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.20 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|