C10H16F3N3O2 — CID 103367520
3-[(2-cyano-3,3,3-trifluoropropyl)amino]-N-(2-methoxyethyl)propanamide (PubChem CID 103367520) has the molecular formula C10H16F3N3O2 and a molecular weight of 267.25 g/mol. Its IUPAC name is 3-[(2-cyano-3,3,3-trifluoropropyl)amino]-N-(2-methoxyethyl)propanamide.
| Compound Name | 3-[(2-cyano-3,3,3-trifluoropropyl)amino]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 103367520 |
| Molecular Formula | C10H16F3N3O2 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 3-[(2-cyano-3,3,3-trifluoropropyl)amino]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)CCNCC(C#N)C(F)(F)F |
| InChI | InChI=1S/C10H16F3N3O2/c1-18-5-4-16-9(17)2-3-15-7-8(6-14)10(11,12)13/h8,15H,2-5,7H2,1H3,(H,16,17) |
| InChIKey | OQRXGQKHIWYGRR-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|