C11H22N2O5 — CID 104645029
methyl 2-hydroxy-3-[[3-(2-methoxyethylamino)-3-oxopropyl]amino]-2-methylpropanoate (PubChem CID 104645029) has the molecular formula C11H22N2O5 and a molecular weight of 262.31 g/mol. Its IUPAC name is methyl 2-hydroxy-3-[[3-(2-methoxyethylamino)-3-oxopropyl]amino]-2-methylpropanoate.
| Compound Name | methyl 2-hydroxy-3-[[3-(2-methoxyethylamino)-3-oxopropyl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 104645029 |
| Molecular Formula | C11H22N2O5 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | methyl 2-hydroxy-3-[[3-(2-methoxyethylamino)-3-oxopropyl]amino]-2-methylpropanoate |
| SMILES | COCCNC(=O)CCNCC(C)(O)C(=O)OC |
| InChI | InChI=1S/C11H22N2O5/c1-11(16,10(15)18-3)8-12-5-4-9(14)13-6-7-17-2/h12,16H,4-8H2,1-3H3,(H,13,14) |
| InChIKey | LNRRFJWWAOVRCV-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|