C9H19N3O4 — CID 103263247
2-amino-3-[[3-(2-methoxyethylamino)-3-oxopropyl]amino]propanoic acid (PubChem CID 103263247) has the molecular formula C9H19N3O4 and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-amino-3-[[3-(2-methoxyethylamino)-3-oxopropyl]amino]propanoic acid.
| Compound Name | 2-amino-3-[[3-(2-methoxyethylamino)-3-oxopropyl]amino]propanoic acid |
|---|---|
| PubChem CID | 103263247 |
| Molecular Formula | C9H19N3O4 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 2-amino-3-[[3-(2-methoxyethylamino)-3-oxopropyl]amino]propanoic acid |
| SMILES | COCCNC(=O)CCNCC(N)C(=O)O |
| InChI | InChI=1S/C9H19N3O4/c1-16-5-4-12-8(13)2-3-11-6-7(10)9(14)15/h7,11H,2-6,10H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | BENGZKHFZWOSKJ-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|