C21H18N2O2 — CID 10336752
(E)-4,4-dimethyl-3-[(3-oxo-2-benzofuran-1-ylidene)amino]-2-phenylpent-2-enenitrile (PubChem CID 10336752) has the molecular formula C21H18N2O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is (E)-4,4-dimethyl-3-[(3-oxo-2-benzofuran-1-ylidene)amino]-2-phenylpent-2-enenitrile.
| Compound Name | (E)-4,4-dimethyl-3-[(3-oxo-2-benzofuran-1-ylidene)amino]-2-phenylpent-2-enenitrile |
|---|---|
| PubChem CID | 10336752 |
| Molecular Formula | C21H18N2O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | (E)-4,4-dimethyl-3-[(3-oxo-2-benzofuran-1-ylidene)amino]-2-phenylpent-2-enenitrile |
| SMILES | CC(C)(C)C(/N=C1\OC(=O)c2ccccc21)=C(\C#N)c1ccccc1 |
| InChI | InChI=1S/C21H18N2O2/c1-21(2,3)18(17(13-22)14-9-5-4-6-10-14)23-19-15-11-7-8-12-16(15)20(24)25-19/h4-12H,1-3H3/b18-17-,23-19- |
| InChIKey | SEVLMLDUNHLLNK-YJEQNTCCSA-N |
| XLogP | 4.58 |
| TPSA | 62.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|