C9H16F3N3S — CID 103368474
3,3,3-trifluoro-2-[(4-methylpiperazin-1-yl)methyl]propanethioamide (PubChem CID 103368474) has the molecular formula C9H16F3N3S and a molecular weight of 255.31 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(4-methylpiperazin-1-yl)methyl]propanethioamide.
| Compound Name | 3,3,3-trifluoro-2-[(4-methylpiperazin-1-yl)methyl]propanethioamide |
|---|---|
| PubChem CID | 103368474 |
| Molecular Formula | C9H16F3N3S |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 3,3,3-trifluoro-2-[(4-methylpiperazin-1-yl)methyl]propanethioamide |
| SMILES | CN1CCN(CC(C(N)=S)C(F)(F)F)CC1 |
| InChI | InChI=1S/C9H16F3N3S/c1-14-2-4-15(5-3-14)6-7(8(13)16)9(10,11)12/h7H,2-6H2,1H3,(H2,13,16) |
| InChIKey | GLILFGDZUNCNCP-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|