C12H12F3N3OS — CID 103368513
3,3,3-trifluoro-2-[(3-oxo-2,4-dihydroquinoxalin-1-yl)methyl]propanethioamide (PubChem CID 103368513) has the molecular formula C12H12F3N3OS and a molecular weight of 303.31 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(3-oxo-2,4-dihydroquinoxalin-1-yl)methyl]propanethioamide.
| Compound Name | 3,3,3-trifluoro-2-[(3-oxo-2,4-dihydroquinoxalin-1-yl)methyl]propanethioamide |
|---|---|
| PubChem CID | 103368513 |
| Molecular Formula | C12H12F3N3OS |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 3,3,3-trifluoro-2-[(3-oxo-2,4-dihydroquinoxalin-1-yl)methyl]propanethioamide |
| SMILES | NC(=S)C(CN1CC(=O)Nc2ccccc21)C(F)(F)F |
| InChI | InChI=1S/C12H12F3N3OS/c13-12(14,15)7(11(16)20)5-18-6-10(19)17-8-3-1-2-4-9(8)18/h1-4,7H,5-6H2,(H2,16,20)(H,17,19) |
| InChIKey | WNVBNKRKELBWNY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|