C12H21F3N2OS — CID 103368641
2-[[cyclohexyl(2-hydroxyethyl)amino]methyl]-3,3,3-trifluoropropanethioamide (PubChem CID 103368641) has the molecular formula C12H21F3N2OS and a molecular weight of 298.37 g/mol. Its IUPAC name is 2-[[cyclohexyl(2-hydroxyethyl)amino]methyl]-3,3,3-trifluoropropanethioamide.
| Compound Name | 2-[[cyclohexyl(2-hydroxyethyl)amino]methyl]-3,3,3-trifluoropropanethioamide |
|---|---|
| PubChem CID | 103368641 |
| Molecular Formula | C12H21F3N2OS |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 2-[[cyclohexyl(2-hydroxyethyl)amino]methyl]-3,3,3-trifluoropropanethioamide |
| SMILES | NC(=S)C(CN(CCO)C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C12H21F3N2OS/c13-12(14,15)10(11(16)19)8-17(6-7-18)9-4-2-1-3-5-9/h9-10,18H,1-8H2,(H2,16,19) |
| InChIKey | BAXYYQBLWUAVQI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|