C12H24F3N3O2 — CID 103369354
3,3,3-trifluoro-N'-hydroxy-2-[[2-methoxyethyl(pentan-3-yl)amino]methyl]propanimidamide (PubChem CID 103369354) has the molecular formula C12H24F3N3O2 and a molecular weight of 299.34 g/mol. Its IUPAC name is 3,3,3-trifluoro-N'-hydroxy-2-[[2-methoxyethyl(pentan-3-yl)amino]methyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-N'-hydroxy-2-[[2-methoxyethyl(pentan-3-yl)amino]methyl]propanimidamide |
|---|---|
| PubChem CID | 103369354 |
| Molecular Formula | C12H24F3N3O2 |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | 3,3,3-trifluoro-N'-hydroxy-2-[[2-methoxyethyl(pentan-3-yl)amino]methyl]propanimidamide |
| SMILES | CCC(CC)N(CCOC)CC(C(N)=NO)C(F)(F)F |
| InChI | InChI=1S/C12H24F3N3O2/c1-4-9(5-2)18(6-7-20-3)8-10(11(16)17-19)12(13,14)15/h9-10,19H,4-8H2,1-3H3,(H2,16,17) |
| InChIKey | QJNSFBXMZCXJCH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|