C9H13F6N3O — CID 103369361
2-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide (PubChem CID 103369361) has the molecular formula C9H13F6N3O and a molecular weight of 293.21 g/mol. Its IUPAC name is 2-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide.
| Compound Name | 2-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 103369361 |
| Molecular Formula | C9H13F6N3O |
| Molecular Weight | 293.21 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 2-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
| SMILES | NC(=NO)C(CN(CC(F)(F)F)C1CC1)C(F)(F)F |
| InChI | InChI=1S/C9H13F6N3O/c10-8(11,12)4-18(5-1-2-5)3-6(7(16)17-19)9(13,14)15/h5-6,19H,1-4H2,(H2,16,17) |
| InChIKey | FVJBNNVWZVNNPM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.21 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|