C7H12F3N3O — CID 103369458
2-[(cyclopropylamino)methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide (PubChem CID 103369458) has the molecular formula C7H12F3N3O and a molecular weight of 211.19 g/mol. Its IUPAC name is 2-[(cyclopropylamino)methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide.
| Compound Name | 2-[(cyclopropylamino)methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 103369458 |
| Molecular Formula | C7H12F3N3O |
| Molecular Weight | 211.19 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | 2-[(cyclopropylamino)methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
| SMILES | NC(=NO)C(CNC1CC1)C(F)(F)F |
| InChI | InChI=1S/C7H12F3N3O/c8-7(9,10)5(6(11)13-14)3-12-4-1-2-4/h4-5,12,14H,1-3H2,(H2,11,13) |
| InChIKey | OSTGGHRNMNQIDC-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.19 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|